C24H32 — CID 59611136
9,9,10,10-tetramethyl-2,6-di(propan-2-yl)anthracene (PubChem CID 59611136) has the molecular formula C24H32 and a molecular weight of 320.52 g/mol. Its IUPAC name is 9,9,10,10-tetramethyl-2,6-di(propan-2-yl)anthracene.
| Compound Name | 9,9,10,10-tetramethyl-2,6-di(propan-2-yl)anthracene |
|---|---|
| PubChem CID | 59611136 |
| Molecular Formula | C24H32 |
| Molecular Weight | 320.52 g/mol |
| Exact Mass | 320.25 |
| IUPAC Name | 9,9,10,10-tetramethyl-2,6-di(propan-2-yl)anthracene |
| SMILES | CC(C)c1ccc2c(c1)C(C)(C)c1ccc(C(C)C)cc1C2(C)C |
| InChI | InChI=1S/C24H32/c1-15(2)17-9-11-19-21(13-17)23(5,6)20-12-10-18(16(3)4)14-22(20)24(19,7)8/h9-16H,1-8H3 |
| InChIKey | FOZNXARMOMYUST-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.52 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |