C16H23Cl — CID 97175249
6-[(1R)-1-chloroethyl]-1,1,4,4-tetramethyl-2,3-dihydronaphthalene (PubChem CID 97175249) has the molecular formula C16H23Cl and a molecular weight of 250.81 g/mol. Its IUPAC name is 6-[(1R)-1-chloroethyl]-1,1,4,4-tetramethyl-2,3-dihydronaphthalene.
| Compound Name | 6-[(1R)-1-chloroethyl]-1,1,4,4-tetramethyl-2,3-dihydronaphthalene |
|---|---|
| PubChem CID | 97175249 |
| Molecular Formula | C16H23Cl |
| Molecular Weight | 250.81 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | 6-[(1R)-1-chloroethyl]-1,1,4,4-tetramethyl-2,3-dihydronaphthalene |
| SMILES | C[C@@H](Cl)c1ccc2c(c1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C16H23Cl/c1-11(17)12-6-7-13-14(10-12)16(4,5)9-8-15(13,2)3/h6-7,10-11H,8-9H2,1-5H3/t11-/m1/s1 |
| InChIKey | WJKRYROIIOKJIT-LLVKDONJSA-N |
| XLogP | 5.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.81 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|