C16H24 — CID 140575899
2-tert-butyl-5-propan-2-yl-2,3-dihydro-1H-indene (PubChem CID 140575899) has the molecular formula C16H24 and a molecular weight of 216.37 g/mol. Its IUPAC name is 2-tert-butyl-5-propan-2-yl-2,3-dihydro-1H-indene.
| Compound Name | 2-tert-butyl-5-propan-2-yl-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 140575899 |
| Molecular Formula | C16H24 |
| Molecular Weight | 216.37 g/mol |
| Exact Mass | 216.19 |
| IUPAC Name | 2-tert-butyl-5-propan-2-yl-2,3-dihydro-1H-indene |
| SMILES | CC(C)c1ccc2c(c1)CC(C(C)(C)C)C2 |
| InChI | InChI=1S/C16H24/c1-11(2)12-6-7-13-9-15(16(3,4)5)10-14(13)8-12/h6-8,11,15H,9-10H2,1-5H3 |
| InChIKey | XTSNKSRXPCHPJN-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.37 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |