C18H26N2 — CID 143074032
5-propan-2-yl-1'-prop-2-enylspiro[1,2-dihydroindole-3,4'-piperidine] (PubChem CID 143074032) has the molecular formula C18H26N2 and a molecular weight of 270.42 g/mol. Its IUPAC name is 5-propan-2-yl-1'-prop-2-enylspiro[1,2-dihydroindole-3,4'-piperidine].
| Compound Name | 5-propan-2-yl-1'-prop-2-enylspiro[1,2-dihydroindole-3,4'-piperidine] |
|---|---|
| PubChem CID | 143074032 |
| Molecular Formula | C18H26N2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.21 |
| IUPAC Name | 5-propan-2-yl-1'-prop-2-enylspiro[1,2-dihydroindole-3,4'-piperidine] |
| SMILES | C=CCN1CCC2(CC1)CNc1ccc(C(C)C)cc12 |
| InChI | InChI=1S/C18H26N2/c1-4-9-20-10-7-18(8-11-20)13-19-17-6-5-15(14(2)3)12-16(17)18/h4-6,12,14,19H,1,7-11,13H2,2-3H3 |
| InChIKey | UFLNYGDNHGYWCQ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|