C21H30N2O2 — CID 23991716
1-(5-methoxy-1'-prop-2-enylspiro[2H-indole-3,4'-piperidine]-1-yl)-3-methylbutan-1-one (PubChem CID 23991716) has the molecular formula C21H30N2O2 and a molecular weight of 342.48 g/mol. Its IUPAC name is 1-(5-methoxy-1'-prop-2-enylspiro[2H-indole-3,4'-piperidine]-1-yl)-3-methylbutan-1-one.
| Compound Name | 1-(5-methoxy-1'-prop-2-enylspiro[2H-indole-3,4'-piperidine]-1-yl)-3-methylbutan-1-one |
|---|---|
| PubChem CID | 23991716 |
| Molecular Formula | C21H30N2O2 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.23 |
| IUPAC Name | 1-(5-methoxy-1'-prop-2-enylspiro[2H-indole-3,4'-piperidine]-1-yl)-3-methylbutan-1-one |
| SMILES | C=CCN1CCC2(CC1)CN(C(=O)CC(C)C)c1ccc(OC)cc12 |
| InChI | InChI=1S/C21H30N2O2/c1-5-10-22-11-8-21(9-12-22)15-23(20(24)13-16(2)3)19-7-6-17(25-4)14-18(19)21/h5-7,14,16H,1,8-13,15H2,2-4H3 |
| InChIKey | AUOXWPAMBPPYLW-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|