C29H32N2O2 — CID 23997047
[5-methoxy-1'-(3-methylbut-2-enyl)spiro[2H-indole-3,4'-piperidine]-1-yl]-naphthalen-2-ylmethanone (PubChem CID 23997047) has the molecular formula C29H32N2O2 and a molecular weight of 440.59 g/mol. Its IUPAC name is [5-methoxy-1'-(3-methylbut-2-enyl)spiro[2H-indole-3,4'-piperidine]-1-yl]-naphthalen-2-ylmethanone.
| Compound Name | [5-methoxy-1'-(3-methylbut-2-enyl)spiro[2H-indole-3,4'-piperidine]-1-yl]-naphthalen-2-ylmethanone |
|---|---|
| PubChem CID | 23997047 |
| Molecular Formula | C29H32N2O2 |
| Molecular Weight | 440.59 g/mol |
| Exact Mass | 440.25 |
| IUPAC Name | [5-methoxy-1'-(3-methylbut-2-enyl)spiro[2H-indole-3,4'-piperidine]-1-yl]-naphthalen-2-ylmethanone |
| SMILES | COc1ccc2c(c1)C1(CCN(CC=C(C)C)CC1)CN2C(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C29H32N2O2/c1-21(2)12-15-30-16-13-29(14-17-30)20-31(27-11-10-25(33-3)19-26(27)29)28(32)24-9-8-22-6-4-5-7-23(22)18-24/h4-12,18-19H,13-17,20H2,1-3H3 |
| InChIKey | NQMNBZKZWCCCMS-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.59 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|