C21H25N3O2 — CID 23851756
(5-methyl-1,2-oxazol-3-yl)-(5-methyl-1'-prop-2-enylspiro[2H-indole-3,4'-piperidine]-1-yl)methanone (PubChem CID 23851756) has the molecular formula C21H25N3O2 and a molecular weight of 351.45 g/mol. Its IUPAC name is (5-methyl-1,2-oxazol-3-yl)-(5-methyl-1'-prop-2-enylspiro[2H-indole-3,4'-piperidine]-1-yl)methanone.
| Compound Name | (5-methyl-1,2-oxazol-3-yl)-(5-methyl-1'-prop-2-enylspiro[2H-indole-3,4'-piperidine]-1-yl)methanone |
|---|---|
| PubChem CID | 23851756 |
| Molecular Formula | C21H25N3O2 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | (5-methyl-1,2-oxazol-3-yl)-(5-methyl-1'-prop-2-enylspiro[2H-indole-3,4'-piperidine]-1-yl)methanone |
| SMILES | C=CCN1CCC2(CC1)CN(C(=O)c1cc(C)on1)c1ccc(C)cc12 |
| InChI | InChI=1S/C21H25N3O2/c1-4-9-23-10-7-21(8-11-23)14-24(19-6-5-15(2)12-17(19)21)20(25)18-13-16(3)26-22-18/h4-6,12-13H,1,7-11,14H2,2-3H3 |
| InChIKey | YCTWRUTZAPLSCV-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 49.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|