C24H30N2OS — CID 23961555
1-[5-methyl-1'-(3-methylbut-2-enyl)spiro[2H-indole-3,4'-piperidine]-1-yl]-2-thiophen-2-ylethanone (PubChem CID 23961555) has the molecular formula C24H30N2OS and a molecular weight of 394.58 g/mol. Its IUPAC name is 1-[5-methyl-1'-(3-methylbut-2-enyl)spiro[2H-indole-3,4'-piperidine]-1-yl]-2-thiophen-2-ylethanone.
| Compound Name | 1-[5-methyl-1'-(3-methylbut-2-enyl)spiro[2H-indole-3,4'-piperidine]-1-yl]-2-thiophen-2-ylethanone |
|---|---|
| PubChem CID | 23961555 |
| Molecular Formula | C24H30N2OS |
| Molecular Weight | 394.58 g/mol |
| Exact Mass | 394.21 |
| IUPAC Name | 1-[5-methyl-1'-(3-methylbut-2-enyl)spiro[2H-indole-3,4'-piperidine]-1-yl]-2-thiophen-2-ylethanone |
| SMILES | CC(C)=CCN1CCC2(CC1)CN(C(=O)Cc1cccs1)c1ccc(C)cc12 |
| InChI | InChI=1S/C24H30N2OS/c1-18(2)8-11-25-12-9-24(10-13-25)17-26(22-7-6-19(3)15-21(22)24)23(27)16-20-5-4-14-28-20/h4-8,14-15H,9-13,16-17H2,1-3H3 |
| InChIKey | DCXSBKOFNWZFMO-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.58 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|