C21H30FN3O — CID 23769084
5-fluoro-1'-(3-methylbut-2-enyl)-N-propylspiro[2H-indole-3,4'-piperidine]-1-carboxamide (PubChem CID 23769084) has the molecular formula C21H30FN3O and a molecular weight of 359.49 g/mol. Its IUPAC name is 5-fluoro-1'-(3-methylbut-2-enyl)-N-propylspiro[2H-indole-3,4'-piperidine]-1-carboxamide.
| Compound Name | 5-fluoro-1'-(3-methylbut-2-enyl)-N-propylspiro[2H-indole-3,4'-piperidine]-1-carboxamide |
|---|---|
| PubChem CID | 23769084 |
| Molecular Formula | C21H30FN3O |
| Molecular Weight | 359.49 g/mol |
| Exact Mass | 359.24 |
| IUPAC Name | 5-fluoro-1'-(3-methylbut-2-enyl)-N-propylspiro[2H-indole-3,4'-piperidine]-1-carboxamide |
| SMILES | CCCNC(=O)N1CC2(CCN(CC=C(C)C)CC2)c2cc(F)ccc21 |
| InChI | InChI=1S/C21H30FN3O/c1-4-10-23-20(26)25-15-21(18-14-17(22)5-6-19(18)25)8-12-24(13-9-21)11-7-16(2)3/h5-7,14H,4,8-13,15H2,1-3H3,(H,23,26) |
| InChIKey | BVWSYZZUWSXHFW-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.49 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|