C14H15FN2O4 — CID 149159822
5-fluorospiro[2H-indole-3,4'-piperidine]-1,1'-dicarboxylic acid (PubChem CID 149159822) has the molecular formula C14H15FN2O4 and a molecular weight of 294.28 g/mol. Its IUPAC name is 5-fluorospiro[2H-indole-3,4'-piperidine]-1,1'-dicarboxylic acid.
| Compound Name | 5-fluorospiro[2H-indole-3,4'-piperidine]-1,1'-dicarboxylic acid |
|---|---|
| PubChem CID | 149159822 |
| Molecular Formula | C14H15FN2O4 |
| Molecular Weight | 294.28 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 5-fluorospiro[2H-indole-3,4'-piperidine]-1,1'-dicarboxylic acid |
| SMILES | O=C(O)N1CCC2(CC1)CN(C(=O)O)c1ccc(F)cc12 |
| InChI | InChI=1S/C14H15FN2O4/c15-9-1-2-11-10(7-9)14(8-17(11)13(20)21)3-5-16(6-4-14)12(18)19/h1-2,7H,3-6,8H2,(H,18,19)(H,20,21) |
| InChIKey | BNEQCFJQCWLLMQ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.28 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |