C13H15FN2O2 — CID 175853428
1'-fluorospiro[2H-indole-3,4'-piperidine]-1-carboxylic acid (PubChem CID 175853428) has the molecular formula C13H15FN2O2 and a molecular weight of 250.27 g/mol. Its IUPAC name is 1'-fluorospiro[2H-indole-3,4'-piperidine]-1-carboxylic acid.
| Compound Name | 1'-fluorospiro[2H-indole-3,4'-piperidine]-1-carboxylic acid |
|---|---|
| PubChem CID | 175853428 |
| Molecular Formula | C13H15FN2O2 |
| Molecular Weight | 250.27 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | 1'-fluorospiro[2H-indole-3,4'-piperidine]-1-carboxylic acid |
| SMILES | O=C(O)N1CC2(CCN(F)CC2)c2ccccc21 |
| InChI | InChI=1S/C13H15FN2O2/c14-15-7-5-13(6-8-15)9-16(12(17)18)11-4-2-1-3-10(11)13/h1-4H,5-9H2,(H,17,18) |
| InChIKey | ZZHRJVKSBHTYSF-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.27 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|