C27H22F3N3O4 — CID 171684331
[5-fluoro-1'-(3-fluoro-2-nitrobenzoyl)spiro[2H-indole-3,4'-piperidine]-1-yl]-(3-fluoro-2-methylphenyl)methanone (PubChem CID 171684331) has the molecular formula C27H22F3N3O4 and a molecular weight of 509.48 g/mol. Its IUPAC name is [5-fluoro-1'-(3-fluoro-2-nitrobenzoyl)spiro[2H-indole-3,4'-piperidine]-1-yl]-(3-fluoro-2-methylphenyl)methanone.
| Compound Name | [5-fluoro-1'-(3-fluoro-2-nitrobenzoyl)spiro[2H-indole-3,4'-piperidine]-1-yl]-(3-fluoro-2-methylphenyl)methanone |
|---|---|
| PubChem CID | 171684331 |
| Molecular Formula | C27H22F3N3O4 |
| Molecular Weight | 509.48 g/mol |
| Exact Mass | 509.16 |
| IUPAC Name | [5-fluoro-1'-(3-fluoro-2-nitrobenzoyl)spiro[2H-indole-3,4'-piperidine]-1-yl]-(3-fluoro-2-methylphenyl)methanone |
| SMILES | Cc1c(F)cccc1C(=O)N1CC2(CCN(C(=O)c3cccc(F)c3[N+](=O)[O-])CC2)c2cc(F)ccc21 |
| InChI | InChI=1S/C27H22F3N3O4/c1-16-18(4-2-6-21(16)29)26(35)32-15-27(20-14-17(28)8-9-23(20)32)10-12-31(13-11-27)25(34)19-5-3-7-22(30)24(19)33(36)37/h2-9,14H,10-13,15H2,1H3 |
| InChIKey | BRXQBGKCKDCKPL-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 83.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.48 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|