C26H24F2N4O3 — CID 23932421
5-fluoro-N-(3-fluorophenyl)-1'-[(4-nitrophenyl)methyl]spiro[2H-indole-3,4'-piperidine]-1-carboxamide (PubChem CID 23932421) has the molecular formula C26H24F2N4O3 and a molecular weight of 478.50 g/mol. Its IUPAC name is 5-fluoro-N-(3-fluorophenyl)-1'-[(4-nitrophenyl)methyl]spiro[2H-indole-3,4'-piperidine]-1-carboxamide.
| Compound Name | 5-fluoro-N-(3-fluorophenyl)-1'-[(4-nitrophenyl)methyl]spiro[2H-indole-3,4'-piperidine]-1-carboxamide |
|---|---|
| PubChem CID | 23932421 |
| Molecular Formula | C26H24F2N4O3 |
| Molecular Weight | 478.50 g/mol |
| Exact Mass | 478.18 |
| IUPAC Name | 5-fluoro-N-(3-fluorophenyl)-1'-[(4-nitrophenyl)methyl]spiro[2H-indole-3,4'-piperidine]-1-carboxamide |
| SMILES | O=C(Nc1cccc(F)c1)N1CC2(CCN(Cc3ccc([N+](=O)[O-])cc3)CC2)c2cc(F)ccc21 |
| InChI | InChI=1S/C26H24F2N4O3/c27-19-2-1-3-21(14-19)29-25(33)31-17-26(23-15-20(28)6-9-24(23)31)10-12-30(13-11-26)16-18-4-7-22(8-5-18)32(34)35/h1-9,14-15H,10-13,16-17H2,(H,29,33) |
| InChIKey | MQAZJCMDYWKEIZ-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 78.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.50 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|