C25H30FN3O — CID 23740559
N-(3-fluorophenyl)-5-methyl-1'-(3-methylbut-2-enyl)spiro[2H-indole-3,4'-piperidine]-1-carboxamide (PubChem CID 23740559) has the molecular formula C25H30FN3O and a molecular weight of 407.53 g/mol. Its IUPAC name is N-(3-fluorophenyl)-5-methyl-1'-(3-methylbut-2-enyl)spiro[2H-indole-3,4'-piperidine]-1-carboxamide.
| Compound Name | N-(3-fluorophenyl)-5-methyl-1'-(3-methylbut-2-enyl)spiro[2H-indole-3,4'-piperidine]-1-carboxamide |
|---|---|
| PubChem CID | 23740559 |
| Molecular Formula | C25H30FN3O |
| Molecular Weight | 407.53 g/mol |
| Exact Mass | 407.24 |
| IUPAC Name | N-(3-fluorophenyl)-5-methyl-1'-(3-methylbut-2-enyl)spiro[2H-indole-3,4'-piperidine]-1-carboxamide |
| SMILES | CC(C)=CCN1CCC2(CC1)CN(C(=O)Nc1cccc(F)c1)c1ccc(C)cc12 |
| InChI | InChI=1S/C25H30FN3O/c1-18(2)9-12-28-13-10-25(11-14-28)17-29(23-8-7-19(3)15-22(23)25)24(30)27-21-6-4-5-20(26)16-21/h4-9,15-16H,10-14,17H2,1-3H3,(H,27,30) |
| InChIKey | KCCTVCYVUBFBDI-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.53 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|