C26H23Cl2FN4O3 — CID 23735545
N-(3,4-dichlorophenyl)-5-fluoro-1'-[(4-nitrophenyl)methyl]spiro[2H-indole-3,4'-piperidine]-1-carboxamide (PubChem CID 23735545) has the molecular formula C26H23Cl2FN4O3 and a molecular weight of 529.40 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-5-fluoro-1'-[(4-nitrophenyl)methyl]spiro[2H-indole-3,4'-piperidine]-1-carboxamide.
| Compound Name | N-(3,4-dichlorophenyl)-5-fluoro-1'-[(4-nitrophenyl)methyl]spiro[2H-indole-3,4'-piperidine]-1-carboxamide |
|---|---|
| PubChem CID | 23735545 |
| Molecular Formula | C26H23Cl2FN4O3 |
| Molecular Weight | 529.40 g/mol |
| Exact Mass | 528.11 |
| IUPAC Name | N-(3,4-dichlorophenyl)-5-fluoro-1'-[(4-nitrophenyl)methyl]spiro[2H-indole-3,4'-piperidine]-1-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)c(Cl)c1)N1CC2(CCN(Cc3ccc([N+](=O)[O-])cc3)CC2)c2cc(F)ccc21 |
| InChI | InChI=1S/C26H23Cl2FN4O3/c27-22-7-4-19(14-23(22)28)30-25(34)32-16-26(21-13-18(29)3-8-24(21)32)9-11-31(12-10-26)15-17-1-5-20(6-2-17)33(35)36/h1-8,13-14H,9-12,15-16H2,(H,30,34) |
| InChIKey | AMXIPZJJBKQVGO-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 78.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.40 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|