C25H32FN3O3 — CID 143399570
(1'-butyl-5-fluorospiro[2H-indole-3,4'-piperidine]-1-yl)-(4-nitrophenyl)methanone;ethane (PubChem CID 143399570) has the molecular formula C25H32FN3O3 and a molecular weight of 441.55 g/mol. Its IUPAC name is (1'-butyl-5-fluorospiro[2H-indole-3,4'-piperidine]-1-yl)-(4-nitrophenyl)methanone;ethane.
| Compound Name | (1'-butyl-5-fluorospiro[2H-indole-3,4'-piperidine]-1-yl)-(4-nitrophenyl)methanone;ethane |
|---|---|
| PubChem CID | 143399570 |
| Molecular Formula | C25H32FN3O3 |
| Molecular Weight | 441.55 g/mol |
| Exact Mass | 441.24 |
| IUPAC Name | (1'-butyl-5-fluorospiro[2H-indole-3,4'-piperidine]-1-yl)-(4-nitrophenyl)methanone;ethane |
| SMILES | CC.CCCCN1CCC2(CC1)CN(C(=O)c1ccc([N+](=O)[O-])cc1)c1ccc(F)cc12 |
| InChI | InChI=1S/C23H26FN3O3.C2H6/c1-2-3-12-25-13-10-23(11-14-25)16-26(21-9-6-18(24)15-20(21)23)22(28)17-4-7-19(8-5-17)27(29)30;1-2/h4-9,15H,2-3,10-14,16H2,1H3;1-2H3 |
| InChIKey | DNMSLMYYZKRFEY-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 66.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.55 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|