C28H24F3N3O4 — CID 171685485
1-[1'-(3,4-difluoro-2-methylbenzoyl)spiro[2H-indole-3,4'-piperidine]-1-yl]-2-(2-fluoro-4-nitrophenyl)ethanone (PubChem CID 171685485) has the molecular formula C28H24F3N3O4 and a molecular weight of 523.51 g/mol. Its IUPAC name is 1-[1'-(3,4-difluoro-2-methylbenzoyl)spiro[2H-indole-3,4'-piperidine]-1-yl]-2-(2-fluoro-4-nitrophenyl)ethanone.
| Compound Name | 1-[1'-(3,4-difluoro-2-methylbenzoyl)spiro[2H-indole-3,4'-piperidine]-1-yl]-2-(2-fluoro-4-nitrophenyl)ethanone |
|---|---|
| PubChem CID | 171685485 |
| Molecular Formula | C28H24F3N3O4 |
| Molecular Weight | 523.51 g/mol |
| Exact Mass | 523.17 |
| IUPAC Name | 1-[1'-(3,4-difluoro-2-methylbenzoyl)spiro[2H-indole-3,4'-piperidine]-1-yl]-2-(2-fluoro-4-nitrophenyl)ethanone |
| SMILES | Cc1c(C(=O)N2CCC3(CC2)CN(C(=O)Cc2ccc([N+](=O)[O-])cc2F)c2ccccc23)ccc(F)c1F |
| InChI | InChI=1S/C28H24F3N3O4/c1-17-20(8-9-22(29)26(17)31)27(36)32-12-10-28(11-13-32)16-33(24-5-3-2-4-21(24)28)25(35)14-18-6-7-19(34(37)38)15-23(18)30/h2-9,15H,10-14,16H2,1H3 |
| InChIKey | QWHWDKJCYFCCHJ-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 83.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.51 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|