C36H40O4 — CID 157385914
2-(2-hydroxy-5-propan-2-ylphenyl)-4-propan-2-ylphenol;2-(2-hydroxy-5-prop-2-enylphenyl)-4-prop-2-enylphenol (PubChem CID 157385914) has the molecular formula C36H40O4 and a molecular weight of 536.71 g/mol. Its IUPAC name is 2-(2-hydroxy-5-propan-2-ylphenyl)-4-propan-2-ylphenol;2-(2-hydroxy-5-prop-2-enylphenyl)-4-prop-2-enylphenol.
| Compound Name | 2-(2-hydroxy-5-propan-2-ylphenyl)-4-propan-2-ylphenol;2-(2-hydroxy-5-prop-2-enylphenyl)-4-prop-2-enylphenol |
|---|---|
| PubChem CID | 157385914 |
| Molecular Formula | C36H40O4 |
| Molecular Weight | 536.71 g/mol |
| Exact Mass | 536.29 |
| IUPAC Name | 2-(2-hydroxy-5-propan-2-ylphenyl)-4-propan-2-ylphenol;2-(2-hydroxy-5-prop-2-enylphenyl)-4-prop-2-enylphenol |
| SMILES | C=CCc1ccc(O)c(-c2cc(CC=C)ccc2O)c1.CC(C)c1ccc(O)c(-c2cc(C(C)C)ccc2O)c1 |
| InChI | InChI=1S/C18H22O2.C18H18O2/c1-11(2)13-5-7-17(19)15(9-13)16-10-14(12(3)4)6-8-18(16)20;1-3-5-13-7-9-17(19)15(11-13)16-12-14(6-4-2)8-10-18(16)20/h5-12,19-20H,1-4H3;3-4,7-12,19-20H,1-2,5-6H2 |
| InChIKey | BLKRWNZLLYZTKC-UHFFFAOYSA-N |
| XLogP | 9.23 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.71 |
| LogP ≤ 5 | 9.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|