C27H37NO2 — CID 171348933
2-[[bis(2-methylpropyl)amino]methyl]-6-(2-hydroxy-5-prop-2-enylphenyl)-4-prop-2-enylphenol (PubChem CID 171348933) has the molecular formula C27H37NO2 and a molecular weight of 407.60 g/mol. Its IUPAC name is 2-[[bis(2-methylpropyl)amino]methyl]-6-(2-hydroxy-5-prop-2-enylphenyl)-4-prop-2-enylphenol.
| Compound Name | 2-[[bis(2-methylpropyl)amino]methyl]-6-(2-hydroxy-5-prop-2-enylphenyl)-4-prop-2-enylphenol |
|---|---|
| PubChem CID | 171348933 |
| Molecular Formula | C27H37NO2 |
| Molecular Weight | 407.60 g/mol |
| Exact Mass | 407.28 |
| IUPAC Name | 2-[[bis(2-methylpropyl)amino]methyl]-6-(2-hydroxy-5-prop-2-enylphenyl)-4-prop-2-enylphenol |
| SMILES | C=CCc1ccc(O)c(-c2cc(CC=C)cc(CN(CC(C)C)CC(C)C)c2O)c1 |
| InChI | InChI=1S/C27H37NO2/c1-7-9-21-11-12-26(29)24(14-21)25-15-22(10-8-2)13-23(27(25)30)18-28(16-19(3)4)17-20(5)6/h7-8,11-15,19-20,29-30H,1-2,9-10,16-18H2,3-6H3 |
| InChIKey | XLHJTUVNOOLGPK-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.60 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|