C21H24O4 — CID 163005298
(4R,5S)-5-hydroxy-4-[4-hydroxy-3-(2-hydroxy-5-prop-2-enylphenyl)phenyl]hexan-3-one (PubChem CID 163005298) has the molecular formula C21H24O4 and a molecular weight of 340.42 g/mol. Its IUPAC name is (4R,5S)-5-hydroxy-4-[4-hydroxy-3-(2-hydroxy-5-prop-2-enylphenyl)phenyl]hexan-3-one.
| Compound Name | (4R,5S)-5-hydroxy-4-[4-hydroxy-3-(2-hydroxy-5-prop-2-enylphenyl)phenyl]hexan-3-one |
|---|---|
| PubChem CID | 163005298 |
| Molecular Formula | C21H24O4 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | (4R,5S)-5-hydroxy-4-[4-hydroxy-3-(2-hydroxy-5-prop-2-enylphenyl)phenyl]hexan-3-one |
| SMILES | C=CCc1ccc(O)c(-c2cc([C@@H](C(=O)CC)[C@H](C)O)ccc2O)c1 |
| InChI | InChI=1S/C21H24O4/c1-4-6-14-7-9-19(24)16(11-14)17-12-15(8-10-20(17)25)21(13(3)22)18(23)5-2/h4,7-13,21-22,24-25H,1,5-6H2,2-3H3/t13-,21-/m0/s1 |
| InChIKey | AATSUAREALGPHF-ZSEKCTLFSA-N |
| XLogP | 3.94 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|