C19H22O3 — CID 163721087
2-(2-hydroxy-5-prop-2-enylphenyl)-4-(3-methoxypropyl)phenol (PubChem CID 163721087) has the molecular formula C19H22O3 and a molecular weight of 298.38 g/mol. Its IUPAC name is 2-(2-hydroxy-5-prop-2-enylphenyl)-4-(3-methoxypropyl)phenol.
| Compound Name | 2-(2-hydroxy-5-prop-2-enylphenyl)-4-(3-methoxypropyl)phenol |
|---|---|
| PubChem CID | 163721087 |
| Molecular Formula | C19H22O3 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | 2-(2-hydroxy-5-prop-2-enylphenyl)-4-(3-methoxypropyl)phenol |
| SMILES | C=CCc1ccc(O)c(-c2cc(CCCOC)ccc2O)c1 |
| InChI | InChI=1S/C19H22O3/c1-3-5-14-7-9-18(20)16(12-14)17-13-15(6-4-11-22-2)8-10-19(17)21/h3,7-10,12-13,20-21H,1,4-6,11H2,2H3 |
| InChIKey | KRQVZLBYPAQUGM-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|