C18H18O3 — CID 102144038
7-(2-hydroxy-5-prop-2-enylphenyl)-2,3-dihydro-1H-indene-2,4-diol (PubChem CID 102144038) has the molecular formula C18H18O3 and a molecular weight of 282.34 g/mol. Its IUPAC name is 7-(2-hydroxy-5-prop-2-enylphenyl)-2,3-dihydro-1H-indene-2,4-diol.
| Compound Name | 7-(2-hydroxy-5-prop-2-enylphenyl)-2,3-dihydro-1H-indene-2,4-diol |
|---|---|
| PubChem CID | 102144038 |
| Molecular Formula | C18H18O3 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | 7-(2-hydroxy-5-prop-2-enylphenyl)-2,3-dihydro-1H-indene-2,4-diol |
| SMILES | C=CCc1ccc(O)c(-c2ccc(O)c3c2CC(O)C3)c1 |
| InChI | InChI=1S/C18H18O3/c1-2-3-11-4-6-17(20)15(8-11)13-5-7-18(21)16-10-12(19)9-14(13)16/h2,4-8,12,19-21H,1,3,9-10H2 |
| InChIKey | GHTPJDZBDJFAKY-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|