About 7-(2-hydroxy-5-prop-2-enylphenyl)-2,3-dihydro-1H-indene-2,4-diol
7-(2-hydroxy-5-prop-2-enylphenyl)-2,3-dihydro-1H-indene-2,4-diol (PubChem CID 102144038) has the molecular formula C18H18O3
and a molecular weight of 282.34 g/mol. Its IUPAC name is 7-(2-hydroxy-5-prop-2-enylphenyl)-2,3-dihydro-1H-indene-2,4-diol.
Molecular Properties
| Compound Name | 7-(2-hydroxy-5-prop-2-enylphenyl)-2,3-dihydro-1H-indene-2,4-diol |
| PubChem CID | 102144038 |
| Molecular Formula | C18H18O3 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | 7-(2-hydroxy-5-prop-2-enylphenyl)-2,3-dihydro-1H-indene-2,4-diol |
| SMILES | C=CCc1ccc(O)c(-c2ccc(O)c3c2CC(O)C3)c1 |
| InChI | InChI=1S/C18H18O3/c1-2-3-11-4-6-17(20)15(8-11)13-5-7-18(21)16-10-12(19)9-14(13)16/h2,4-8,12,19-21H,1,3,9-10H2 |
| InChIKey | GHTPJDZBDJFAKY-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 7-(2-hydroxy-5-prop-2-enylphenyl)-2,3-dihydro-1H-indene-2,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(2-hydroxy-5-prop-2-enylphenyl)-2,3-dihydro-1H-indene-2,4-diol?
The IUPAC name of 7-(2-hydroxy-5-prop-2-enylphenyl)-2,3-dihydro-1H-indene-2,4-diol (CID 102144038) is 7-(2-hydroxy-5-prop-2-enylphenyl)-2,3-dihydro-1H-indene-2,4-diol.
What is the SMILES notation for 7-(2-hydroxy-5-prop-2-enylphenyl)-2,3-dihydro-1H-indene-2,4-diol?
The canonical SMILES for 7-(2-hydroxy-5-prop-2-enylphenyl)-2,3-dihydro-1H-indene-2,4-diol is C=CCc1ccc(O)c(-c2ccc(O)c3c2CC(O)C3)c1.
What is the InChIKey of 7-(2-hydroxy-5-prop-2-enylphenyl)-2,3-dihydro-1H-indene-2,4-diol?
The InChIKey is GHTPJDZBDJFAKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18O3/c1-2-3-11-4-6-17(20)15(8-11)13-5-7-18(21)16-10-12(19)9-14(13)16/h2,4-8,12,19-21H,1,3,9-10H2.
What are the key properties of 7-(2-hydroxy-5-prop-2-enylphenyl)-2,3-dihydro-1H-indene-2,4-diol?
7-(2-hydroxy-5-prop-2-enylphenyl)-2,3-dihydro-1H-indene-2,4-diol has a molecular weight of 282.34 g/mol, XLogP of 2.95, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(2-hydroxy-5-prop-2-enylphenyl)-2,3-dihydro-1H-indene-2,4-diol is sourced from PubChem (CID 102144038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).