C27H28O3 — CID 172879849
(3R,4aS,9bS)-6-(2-hydroxy-5-prop-2-enylphenyl)-8,9b-bis(prop-2-enyl)-4,4a-dihydro-3H-dibenzofuran-3-ol (PubChem CID 172879849) has the molecular formula C27H28O3 and a molecular weight of 400.52 g/mol. Its IUPAC name is (3R,4aS,9bS)-6-(2-hydroxy-5-prop-2-enylphenyl)-8,9b-bis(prop-2-enyl)-4,4a-dihydro-3H-dibenzofuran-3-ol.
| Compound Name | (3R,4aS,9bS)-6-(2-hydroxy-5-prop-2-enylphenyl)-8,9b-bis(prop-2-enyl)-4,4a-dihydro-3H-dibenzofuran-3-ol |
|---|---|
| PubChem CID | 172879849 |
| Molecular Formula | C27H28O3 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | (3R,4aS,9bS)-6-(2-hydroxy-5-prop-2-enylphenyl)-8,9b-bis(prop-2-enyl)-4,4a-dihydro-3H-dibenzofuran-3-ol |
| SMILES | C=CCc1ccc(O)c(-c2cc(CC=C)cc3c2O[C@H]2C[C@@H](O)C=C[C@@]32CC=C)c1 |
| InChI | InChI=1S/C27H28O3/c1-4-7-18-9-10-24(29)21(14-18)22-15-19(8-5-2)16-23-26(22)30-25-17-20(28)11-13-27(23,25)12-6-3/h4-6,9-11,13-16,20,25,28-29H,1-3,7-8,12,17H2/t20-,25-,27-/m0/s1 |
| InChIKey | NATVLMBJRGUVLB-OICBGKIFSA-N |
| XLogP | 5.41 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|