C28H38O3 — CID 54509125
2-[2-(10-hydroxydecoxy)-5-prop-2-enylphenyl]-4-prop-2-enylphenol (PubChem CID 54509125) has the molecular formula C28H38O3 and a molecular weight of 422.61 g/mol. Its IUPAC name is 2-[2-(10-hydroxydecoxy)-5-prop-2-enylphenyl]-4-prop-2-enylphenol.
| Compound Name | 2-[2-(10-hydroxydecoxy)-5-prop-2-enylphenyl]-4-prop-2-enylphenol |
|---|---|
| PubChem CID | 54509125 |
| Molecular Formula | C28H38O3 |
| Molecular Weight | 422.61 g/mol |
| Exact Mass | 422.28 |
| IUPAC Name | 2-[2-(10-hydroxydecoxy)-5-prop-2-enylphenyl]-4-prop-2-enylphenol |
| SMILES | C=CCc1ccc(O)c(-c2cc(CC=C)ccc2OCCCCCCCCCCO)c1 |
| InChI | InChI=1S/C28H38O3/c1-3-13-23-15-17-27(30)25(21-23)26-22-24(14-4-2)16-18-28(26)31-20-12-10-8-6-5-7-9-11-19-29/h3-4,15-18,21-22,29-30H,1-2,5-14,19-20H2 |
| InChIKey | YHVVCJDYNVIXDA-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.61 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|