C27H24O3 — CID 155673364
[2-(2-hydroxy-5-prop-2-enylphenyl)-4-prop-2-enylphenyl] 3-phenylprop-2-enoate (PubChem CID 155673364) has the molecular formula C27H24O3 and a molecular weight of 396.49 g/mol. Its IUPAC name is [2-(2-hydroxy-5-prop-2-enylphenyl)-4-prop-2-enylphenyl] 3-phenylprop-2-enoate.
| Compound Name | [2-(2-hydroxy-5-prop-2-enylphenyl)-4-prop-2-enylphenyl] 3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 155673364 |
| Molecular Formula | C27H24O3 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | [2-(2-hydroxy-5-prop-2-enylphenyl)-4-prop-2-enylphenyl] 3-phenylprop-2-enoate |
| SMILES | C=CCc1ccc(O)c(-c2cc(CC=C)ccc2OC(=O)C=Cc2ccccc2)c1 |
| InChI | InChI=1S/C27H24O3/c1-3-8-21-12-15-25(28)23(18-21)24-19-22(9-4-2)13-16-26(24)30-27(29)17-14-20-10-6-5-7-11-20/h3-7,10-19,28H,1-2,8-9H2 |
| InChIKey | BTOXMGWZPLMAPP-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|