C32H26F3NO3 — CID 127027850
[2-(2-hydroxy-5-prop-2-enylphenyl)-4-prop-2-enylphenyl] 2-[3-(trifluoromethyl)anilino]benzoate (PubChem CID 127027850) has the molecular formula C32H26F3NO3 and a molecular weight of 529.56 g/mol. Its IUPAC name is [2-(2-hydroxy-5-prop-2-enylphenyl)-4-prop-2-enylphenyl] 2-[3-(trifluoromethyl)anilino]benzoate.
| Compound Name | [2-(2-hydroxy-5-prop-2-enylphenyl)-4-prop-2-enylphenyl] 2-[3-(trifluoromethyl)anilino]benzoate |
|---|---|
| PubChem CID | 127027850 |
| Molecular Formula | C32H26F3NO3 |
| Molecular Weight | 529.56 g/mol |
| Exact Mass | 529.19 |
| IUPAC Name | [2-(2-hydroxy-5-prop-2-enylphenyl)-4-prop-2-enylphenyl] 2-[3-(trifluoromethyl)anilino]benzoate |
| SMILES | C=CCc1ccc(O)c(-c2cc(CC=C)ccc2OC(=O)c2ccccc2Nc2cccc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C32H26F3NO3/c1-3-8-21-14-16-29(37)26(18-21)27-19-22(9-4-2)15-17-30(27)39-31(38)25-12-5-6-13-28(25)36-24-11-7-10-23(20-24)32(33,34)35/h3-7,10-20,36-37H,1-2,8-9H2 |
| InChIKey | OMBFIPUKSNKRAS-UHFFFAOYSA-N |
| XLogP | 8.50 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.56 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|