C35H28F3NO7 — CID 122184062
[4-[(1E,6E)-7-(4-hydroxy-3-methoxyphenyl)-3,5-dioxohepta-1,6-dienyl]-2-methoxyphenyl] 2-[3-(trifluoromethyl)anilino]benzoate (PubChem CID 122184062) has the molecular formula C35H28F3NO7 and a molecular weight of 631.60 g/mol. Its IUPAC name is [4-[(1E,6E)-7-(4-hydroxy-3-methoxyphenyl)-3,5-dioxohepta-1,6-dienyl]-2-methoxyphenyl] 2-[3-(trifluoromethyl)anilino]benzoate.
| Compound Name | [4-[(1E,6E)-7-(4-hydroxy-3-methoxyphenyl)-3,5-dioxohepta-1,6-dienyl]-2-methoxyphenyl] 2-[3-(trifluoromethyl)anilino]benzoate |
|---|---|
| PubChem CID | 122184062 |
| Molecular Formula | C35H28F3NO7 |
| Molecular Weight | 631.60 g/mol |
| Exact Mass | 631.18 |
| IUPAC Name | [4-[(1E,6E)-7-(4-hydroxy-3-methoxyphenyl)-3,5-dioxohepta-1,6-dienyl]-2-methoxyphenyl] 2-[3-(trifluoromethyl)anilino]benzoate |
| SMILES | COc1cc(/C=C/C(=O)CC(=O)/C=C/c2ccc(OC(=O)c3ccccc3Nc3cccc(C(F)(F)F)c3)c(OC)c2)ccc1O |
| InChI | InChI=1S/C35H28F3NO7/c1-44-32-18-22(12-16-30(32)42)10-14-26(40)21-27(41)15-11-23-13-17-31(33(19-23)45-2)46-34(43)28-8-3-4-9-29(28)39-25-7-5-6-24(20-25)35(36,37)38/h3-20,39,42H,21H2,1-2H3/b14-10+,15-11+ |
| InChIKey | SBVZFSAPYZZNIR-WFYKWJGLSA-N |
| XLogP | 7.65 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.60 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|