C49H40Cl2N2O8 — CID 122184082
[4-[(1E,6E)-7-[4-[2-(3-chloro-2-methylanilino)benzoyl]oxy-3-methoxyphenyl]-3,5-dioxohepta-1,6-dienyl]-2-methoxyphenyl] 2-(3-chloro-2-methylanilino)benzoate (PubChem CID 122184082) has the molecular formula C49H40Cl2N2O8 and a molecular weight of 855.77 g/mol. Its IUPAC name is [4-[(1E,6E)-7-[4-[2-(3-chloro-2-methylanilino)benzoyl]oxy-3-methoxyphenyl]-3,5-dioxohepta-1,6-dienyl]-2-methoxyphenyl] 2-(3-chloro-2-methylanilino)benzoate.
| Compound Name | [4-[(1E,6E)-7-[4-[2-(3-chloro-2-methylanilino)benzoyl]oxy-3-methoxyphenyl]-3,5-dioxohepta-1,6-dienyl]-2-methoxyphenyl] 2-(3-chloro-2-methylanilino)benzoate |
|---|---|
| PubChem CID | 122184082 |
| Molecular Formula | C49H40Cl2N2O8 |
| Molecular Weight | 855.77 g/mol |
| Exact Mass | 854.22 |
| IUPAC Name | [4-[(1E,6E)-7-[4-[2-(3-chloro-2-methylanilino)benzoyl]oxy-3-methoxyphenyl]-3,5-dioxohepta-1,6-dienyl]-2-methoxyphenyl] 2-(3-chloro-2-methylanilino)benzoate |
| SMILES | COc1cc(/C=C/C(=O)CC(=O)/C=C/c2ccc(OC(=O)c3ccccc3Nc3cccc(Cl)c3C)c(OC)c2)ccc1OC(=O)c1ccccc1Nc1cccc(Cl)c1C |
| InChI | InChI=1S/C49H40Cl2N2O8/c1-30-38(50)13-9-17-40(30)52-42-15-7-5-11-36(42)48(56)60-44-25-21-32(27-46(44)58-3)19-23-34(54)29-35(55)24-20-33-22-26-45(47(28-33)59-4)61-49(57)37-12-6-8-16-43(37)53-41-18-10-14-39(51)31(41)2/h5-28,52-53H,29H2,1-4H3/b23-19+,24-20+ |
| InChIKey | QDBBVMMQTAKXMJ-BLVCXSLXSA-N |
| XLogP | 11.81 |
| TPSA | 129.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 855.77 |
| LogP ≤ 5 | 11.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|