C34H34O5 — CID 118955388
2,6-dimethoxy-4-[(E)-2-phenylethenyl]phenol;2-(2-hydroxy-5-prop-2-enylphenyl)-4-prop-2-enylphenol (PubChem CID 118955388) has the molecular formula C34H34O5 and a molecular weight of 522.64 g/mol. Its IUPAC name is 2,6-dimethoxy-4-[(E)-2-phenylethenyl]phenol;2-(2-hydroxy-5-prop-2-enylphenyl)-4-prop-2-enylphenol.
| Compound Name | 2,6-dimethoxy-4-[(E)-2-phenylethenyl]phenol;2-(2-hydroxy-5-prop-2-enylphenyl)-4-prop-2-enylphenol |
|---|---|
| PubChem CID | 118955388 |
| Molecular Formula | C34H34O5 |
| Molecular Weight | 522.64 g/mol |
| Exact Mass | 522.24 |
| IUPAC Name | 2,6-dimethoxy-4-[(E)-2-phenylethenyl]phenol;2-(2-hydroxy-5-prop-2-enylphenyl)-4-prop-2-enylphenol |
| SMILES | C=CCc1ccc(O)c(-c2cc(CC=C)ccc2O)c1.COc1cc(/C=C/c2ccccc2)cc(OC)c1O |
| InChI | InChI=1S/C18H18O2.C16H16O3/c1-3-5-13-7-9-17(19)15(11-13)16-12-14(6-4-2)8-10-18(16)20;1-18-14-10-13(11-15(19-2)16(14)17)9-8-12-6-4-3-5-7-12/h3-4,7-12,19-20H,1-2,5-6H2;3-11,17H,1-2H3/b;9-8+ |
| InChIKey | ZNEAJDXSPQDABI-RJDPJKJLSA-N |
| XLogP | 7.80 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.64 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|