C30H43N2O3+ — CID 164617096
3-[2-(2-hydroxy-5-prop-2-enylphenyl)-4-prop-2-enylphenoxy]propyl-dimethyl-[2-oxo-2-(pentylamino)ethyl]azanium (PubChem CID 164617096) has the molecular formula C30H43N2O3+ and a molecular weight of 479.69 g/mol. Its IUPAC name is 3-[2-(2-hydroxy-5-prop-2-enylphenyl)-4-prop-2-enylphenoxy]propyl-dimethyl-[2-oxo-2-(pentylamino)ethyl]azanium.
| Compound Name | 3-[2-(2-hydroxy-5-prop-2-enylphenyl)-4-prop-2-enylphenoxy]propyl-dimethyl-[2-oxo-2-(pentylamino)ethyl]azanium |
|---|---|
| PubChem CID | 164617096 |
| Molecular Formula | C30H43N2O3+ |
| Molecular Weight | 479.69 g/mol |
| Exact Mass | 479.33 |
| IUPAC Name | 3-[2-(2-hydroxy-5-prop-2-enylphenyl)-4-prop-2-enylphenoxy]propyl-dimethyl-[2-oxo-2-(pentylamino)ethyl]azanium |
| SMILES | C=CCc1ccc(O)c(-c2cc(CC=C)ccc2OCCC[N+](C)(C)CC(=O)NCCCCC)c1 |
| InChI | InChI=1S/C30H42N2O3/c1-6-9-10-18-31-30(34)23-32(4,5)19-11-20-35-29-17-15-25(13-8-3)22-27(29)26-21-24(12-7-2)14-16-28(26)33/h7-8,14-17,21-22H,2-3,6,9-13,18-20,23H2,1,4-5H3,(H-,31,33,34)/p+1 |
| InChIKey | BGYQQCAOAIBECM-UHFFFAOYSA-O |
| XLogP | 5.67 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.69 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|