C30H64N4O2+2 — CID 122212878
[2-[6-[[2-[dimethyl(octyl)azaniumyl]acetyl]amino]hexylamino]-2-oxoethyl]-dimethyl-octylazanium (PubChem CID 122212878) has the molecular formula C30H64N4O2+2 and a molecular weight of 512.87 g/mol. Its IUPAC name is [2-[6-[[2-[dimethyl(octyl)azaniumyl]acetyl]amino]hexylamino]-2-oxoethyl]-dimethyl-octylazanium.
| Compound Name | [2-[6-[[2-[dimethyl(octyl)azaniumyl]acetyl]amino]hexylamino]-2-oxoethyl]-dimethyl-octylazanium |
|---|---|
| PubChem CID | 122212878 |
| Molecular Formula | C30H64N4O2+2 |
| Molecular Weight | 512.87 g/mol |
| Exact Mass | 512.50 |
| IUPAC Name | [2-[6-[[2-[dimethyl(octyl)azaniumyl]acetyl]amino]hexylamino]-2-oxoethyl]-dimethyl-octylazanium |
| SMILES | CCCCCCCC[N+](C)(C)CC(=O)NCCCCCCNC(=O)C[N+](C)(C)CCCCCCCC |
| InChI | InChI=1S/C30H62N4O2/c1-7-9-11-13-17-21-25-33(3,4)27-29(35)31-23-19-15-16-20-24-32-30(36)28-34(5,6)26-22-18-14-12-10-8-2/h7-28H2,1-6H3/p+2 |
| InChIKey | KSEKPGMVWQUSIF-UHFFFAOYSA-P |
| XLogP | 5.65 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.87 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|