C26H54N6O4+2 — CID 122232071
[2-(hexylamino)-2-oxoethyl]-[2-[2-[[2-[[2-(hexylamino)-2-oxoethyl]-dimethylazaniumyl]acetyl]amino]ethylamino]-2-oxoethyl]-dimethylazanium (PubChem CID 122232071) has the molecular formula C26H54N6O4+2 and a molecular weight of 514.76 g/mol. Its IUPAC name is [2-(hexylamino)-2-oxoethyl]-[2-[2-[[2-[[2-(hexylamino)-2-oxoethyl]-dimethylazaniumyl]acetyl]amino]ethylamino]-2-oxoethyl]-dimethylazanium.
| Compound Name | [2-(hexylamino)-2-oxoethyl]-[2-[2-[[2-[[2-(hexylamino)-2-oxoethyl]-dimethylazaniumyl]acetyl]amino]ethylamino]-2-oxoethyl]-dimethylazanium |
|---|---|
| PubChem CID | 122232071 |
| Molecular Formula | C26H54N6O4+2 |
| Molecular Weight | 514.76 g/mol |
| Exact Mass | 514.42 |
| IUPAC Name | [2-(hexylamino)-2-oxoethyl]-[2-[2-[[2-[[2-(hexylamino)-2-oxoethyl]-dimethylazaniumyl]acetyl]amino]ethylamino]-2-oxoethyl]-dimethylazanium |
| SMILES | CCCCCCNC(=O)C[N+](C)(C)CC(=O)NCCNC(=O)C[N+](C)(C)CC(=O)NCCCCCC |
| InChI | InChI=1S/C26H52N6O4/c1-7-9-11-13-15-27-23(33)19-31(3,4)21-25(35)29-17-18-30-26(36)22-32(5,6)20-24(34)28-16-14-12-10-8-2/h7-22H2,1-6H3,(H2-2,27,28,29,30,33,34,35,36)/p+2 |
| InChIKey | WYTIEVXIDUKTGA-UHFFFAOYSA-P |
| XLogP | 0.76 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.76 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|