C32H68N4O4+2 — CID 155523236
2-hydroxyethyl-[6-[2-hydroxyethyl-methyl-[2-(octylamino)-2-oxoethyl]azaniumyl]hexyl]-methyl-[2-(octylamino)-2-oxoethyl]azanium (PubChem CID 155523236) has the molecular formula C32H68N4O4+2 and a molecular weight of 572.92 g/mol. Its IUPAC name is 2-hydroxyethyl-[6-[2-hydroxyethyl-methyl-[2-(octylamino)-2-oxoethyl]azaniumyl]hexyl]-methyl-[2-(octylamino)-2-oxoethyl]azanium.
| Compound Name | 2-hydroxyethyl-[6-[2-hydroxyethyl-methyl-[2-(octylamino)-2-oxoethyl]azaniumyl]hexyl]-methyl-[2-(octylamino)-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 155523236 |
| Molecular Formula | C32H68N4O4+2 |
| Molecular Weight | 572.92 g/mol |
| Exact Mass | 572.52 |
| IUPAC Name | 2-hydroxyethyl-[6-[2-hydroxyethyl-methyl-[2-(octylamino)-2-oxoethyl]azaniumyl]hexyl]-methyl-[2-(octylamino)-2-oxoethyl]azanium |
| SMILES | CCCCCCCCNC(=O)C[N+](C)(CCO)CCCCCC[N+](C)(CCO)CC(=O)NCCCCCCCC |
| InChI | InChI=1S/C32H66N4O4/c1-5-7-9-11-13-17-21-33-31(39)29-35(3,25-27-37)23-19-15-16-20-24-36(4,26-28-38)30-32(40)34-22-18-14-12-10-8-6-2/h37-38H,5-30H2,1-4H3/p+2 |
| InChIKey | VSTGSUJSQVTDMK-UHFFFAOYSA-P |
| XLogP | 4.38 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.92 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|