C42H68Br2N4O4 — CID 164612806
[2-(hexylamino)-2-oxoethyl]-[2-[2-[4-[2-[[2-(hexylamino)-2-oxoethyl]-dimethylazaniumyl]ethoxy]-3-prop-2-enylphenyl]-4-prop-2-enylphenoxy]ethyl]-dimethylazanium dibromide (PubChem CID 164612806) has the molecular formula C42H68Br2N4O4 and a molecular weight of 852.84 g/mol. Its IUPAC name is [2-(hexylamino)-2-oxoethyl]-[2-[2-[4-[2-[[2-(hexylamino)-2-oxoethyl]-dimethylazaniumyl]ethoxy]-3-prop-2-enylphenyl]-4-prop-2-enylphenoxy]ethyl]-dimethylazanium dibromide.
| Compound Name | [2-(hexylamino)-2-oxoethyl]-[2-[2-[4-[2-[[2-(hexylamino)-2-oxoethyl]-dimethylazaniumyl]ethoxy]-3-prop-2-enylphenyl]-4-prop-2-enylphenoxy]ethyl]-dimethylazanium dibromide |
|---|---|
| PubChem CID | 164612806 |
| Molecular Formula | C42H68Br2N4O4 |
| Molecular Weight | 852.84 g/mol |
| Exact Mass | 850.36 |
| IUPAC Name | [2-(hexylamino)-2-oxoethyl]-[2-[2-[4-[2-[[2-(hexylamino)-2-oxoethyl]-dimethylazaniumyl]ethoxy]-3-prop-2-enylphenyl]-4-prop-2-enylphenoxy]ethyl]-dimethylazanium dibromide |
| SMILES | C=CCc1ccc(OCC[N+](C)(C)CC(=O)NCCCCCC)c(-c2ccc(OCC[N+](C)(C)CC(=O)NCCCCCC)c(CC=C)c2)c1.[Br-].[Br-] |
| InChI | InChI=1S/C42H66N4O4.2BrH/c1-9-13-15-17-25-43-41(47)33-45(5,6)27-29-49-39-24-22-36(32-37(39)20-12-4)38-31-35(19-11-3)21-23-40(38)50-30-28-46(7,8)34-42(48)44-26-18-16-14-10-2;;/h11-12,21-24,31-32H,3-4,9-10,13-20,25-30,33-34H2,1-2,5-8H3;2*1H |
| InChIKey | LDSZBQPTDXMESS-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 52 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 852.84 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|