C38H35Cl3O2P+ — CID 165020471
methane;tris(4-chlorophenyl)-[[2-(2-hydroxy-5-prop-2-enylphenyl)-4-prop-2-enylphenoxy]methyl]phosphanium (PubChem CID 165020471) has the molecular formula C38H35Cl3O2P+ and a molecular weight of 661.03 g/mol. Its IUPAC name is methane;tris(4-chlorophenyl)-[[2-(2-hydroxy-5-prop-2-enylphenyl)-4-prop-2-enylphenoxy]methyl]phosphanium.
| Compound Name | methane;tris(4-chlorophenyl)-[[2-(2-hydroxy-5-prop-2-enylphenyl)-4-prop-2-enylphenoxy]methyl]phosphanium |
|---|---|
| PubChem CID | 165020471 |
| Molecular Formula | C38H35Cl3O2P+ |
| Molecular Weight | 661.03 g/mol |
| Exact Mass | 659.14 |
| IUPAC Name | methane;tris(4-chlorophenyl)-[[2-(2-hydroxy-5-prop-2-enylphenyl)-4-prop-2-enylphenoxy]methyl]phosphanium |
| SMILES | C.C=CCc1ccc(O)c(-c2cc(CC=C)ccc2OC[P+](c2ccc(Cl)cc2)(c2ccc(Cl)cc2)c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C37H30Cl3O2P.CH4/c1-3-5-26-7-21-36(41)34(23-26)35-24-27(6-4-2)8-22-37(35)42-25-43(31-15-9-28(38)10-16-31,32-17-11-29(39)12-18-32)33-19-13-30(40)14-20-33;/h3-4,7-24H,1-2,5-6,25H2;1H4/p+1 |
| InChIKey | ZDVDIPMPZMUXFI-UHFFFAOYSA-O |
| XLogP | 10.44 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.03 |
| LogP ≤ 5 | 10.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|