C32H48N2O2 — CID 171352292
2-[[di(propan-2-yl)amino]methyl]-6-[3-[[di(propan-2-yl)amino]methyl]-4-hydroxy-5-prop-2-enylphenyl]-4-prop-2-enylphenol (PubChem CID 171352292) has the molecular formula C32H48N2O2 and a molecular weight of 492.75 g/mol. Its IUPAC name is 2-[[di(propan-2-yl)amino]methyl]-6-[3-[[di(propan-2-yl)amino]methyl]-4-hydroxy-5-prop-2-enylphenyl]-4-prop-2-enylphenol.
| Compound Name | 2-[[di(propan-2-yl)amino]methyl]-6-[3-[[di(propan-2-yl)amino]methyl]-4-hydroxy-5-prop-2-enylphenyl]-4-prop-2-enylphenol |
|---|---|
| PubChem CID | 171352292 |
| Molecular Formula | C32H48N2O2 |
| Molecular Weight | 492.75 g/mol |
| Exact Mass | 492.37 |
| IUPAC Name | 2-[[di(propan-2-yl)amino]methyl]-6-[3-[[di(propan-2-yl)amino]methyl]-4-hydroxy-5-prop-2-enylphenyl]-4-prop-2-enylphenol |
| SMILES | C=CCc1cc(CN(C(C)C)C(C)C)c(O)c(-c2cc(CC=C)c(O)c(CN(C(C)C)C(C)C)c2)c1 |
| InChI | InChI=1S/C32H48N2O2/c1-11-13-25-15-28(19-33(21(3)4)22(5)6)32(36)30(16-25)27-17-26(14-12-2)31(35)29(18-27)20-34(23(7)8)24(9)10/h11-12,15-18,21-24,35-36H,1-2,13-14,19-20H2,3-10H3 |
| InChIKey | OKPXGQZVAMJWNF-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 46.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.75 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|