C24H28N2 — CID 174853050
2-[4-amino-3,5-bis(prop-2-enyl)phenyl]-4,6-bis(prop-2-enyl)aniline (PubChem CID 174853050) has the molecular formula C24H28N2 and a molecular weight of 344.50 g/mol. Its IUPAC name is 2-[4-amino-3,5-bis(prop-2-enyl)phenyl]-4,6-bis(prop-2-enyl)aniline.
| Compound Name | 2-[4-amino-3,5-bis(prop-2-enyl)phenyl]-4,6-bis(prop-2-enyl)aniline |
|---|---|
| PubChem CID | 174853050 |
| Molecular Formula | C24H28N2 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.23 |
| IUPAC Name | 2-[4-amino-3,5-bis(prop-2-enyl)phenyl]-4,6-bis(prop-2-enyl)aniline |
| SMILES | C=CCc1cc(CC=C)c(N)c(-c2cc(CC=C)c(N)c(CC=C)c2)c1 |
| InChI | InChI=1S/C24H28N2/c1-5-9-17-13-18(10-6-2)24(26)22(14-17)21-15-19(11-7-3)23(25)20(16-21)12-8-4/h5-8,13-16H,1-4,9-12,25-26H2 |
| InChIKey | CMGHGKKBXSJOFE-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|