C25H30N2 — CID 66694747
4-[[4-amino-3,5-bis(prop-2-enyl)phenyl]methyl]-2,6-bis(prop-2-enyl)aniline (PubChem CID 66694747) has the molecular formula C25H30N2 and a molecular weight of 358.53 g/mol. Its IUPAC name is 4-[[4-amino-3,5-bis(prop-2-enyl)phenyl]methyl]-2,6-bis(prop-2-enyl)aniline.
| Compound Name | 4-[[4-amino-3,5-bis(prop-2-enyl)phenyl]methyl]-2,6-bis(prop-2-enyl)aniline |
|---|---|
| PubChem CID | 66694747 |
| Molecular Formula | C25H30N2 |
| Molecular Weight | 358.53 g/mol |
| Exact Mass | 358.24 |
| IUPAC Name | 4-[[4-amino-3,5-bis(prop-2-enyl)phenyl]methyl]-2,6-bis(prop-2-enyl)aniline |
| SMILES | C=CCc1cc(Cc2cc(CC=C)c(N)c(CC=C)c2)cc(CC=C)c1N |
| InChI | InChI=1S/C25H30N2/c1-5-9-20-14-18(15-21(10-6-2)24(20)26)13-19-16-22(11-7-3)25(27)23(17-19)12-8-4/h5-8,14-17H,1-4,9-13,26-27H2 |
| InChIKey | KGUGVSXZWOCAAZ-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.53 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|