C21H22O — CID 70152198
4-[2,4,6-tris(prop-2-enyl)phenyl]phenol (PubChem CID 70152198) has the molecular formula C21H22O and a molecular weight of 290.41 g/mol. Its IUPAC name is 4-[2,4,6-tris(prop-2-enyl)phenyl]phenol.
| Compound Name | 4-[2,4,6-tris(prop-2-enyl)phenyl]phenol |
|---|---|
| PubChem CID | 70152198 |
| Molecular Formula | C21H22O |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | 4-[2,4,6-tris(prop-2-enyl)phenyl]phenol |
| SMILES | C=CCc1cc(CC=C)c(-c2ccc(O)cc2)c(CC=C)c1 |
| InChI | InChI=1S/C21H22O/c1-4-7-16-14-18(8-5-2)21(19(15-16)9-6-3)17-10-12-20(22)13-11-17/h4-6,10-15,22H,1-3,7-9H2 |
| InChIKey | FJHONXXZMZKHKR-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|