C18H18O4 — CID 122206277
3-(4,5-dihydroxy-2-prop-2-enylphenyl)-5-prop-2-enylbenzene-1,2-diol (PubChem CID 122206277) has the molecular formula C18H18O4 and a molecular weight of 298.34 g/mol. Its IUPAC name is 3-(4,5-dihydroxy-2-prop-2-enylphenyl)-5-prop-2-enylbenzene-1,2-diol.
| Compound Name | 3-(4,5-dihydroxy-2-prop-2-enylphenyl)-5-prop-2-enylbenzene-1,2-diol |
|---|---|
| PubChem CID | 122206277 |
| Molecular Formula | C18H18O4 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | 3-(4,5-dihydroxy-2-prop-2-enylphenyl)-5-prop-2-enylbenzene-1,2-diol |
| SMILES | C=CCc1cc(O)c(O)c(-c2cc(O)c(O)cc2CC=C)c1 |
| InChI | InChI=1S/C18H18O4/c1-3-5-11-7-14(18(22)17(21)8-11)13-10-16(20)15(19)9-12(13)6-4-2/h3-4,7-10,19-22H,1-2,5-6H2 |
| InChIKey | SJFYFSCGKBUWFP-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|