C25H23F2NO2 — CID 171480729
2-[(3,4-difluorophenyl)methylamino]-6-(2-hydroxy-5-prop-2-enylphenyl)-4-prop-2-enylphenol (PubChem CID 171480729) has the molecular formula C25H23F2NO2 and a molecular weight of 407.46 g/mol. Its IUPAC name is 2-[(3,4-difluorophenyl)methylamino]-6-(2-hydroxy-5-prop-2-enylphenyl)-4-prop-2-enylphenol.
| Compound Name | 2-[(3,4-difluorophenyl)methylamino]-6-(2-hydroxy-5-prop-2-enylphenyl)-4-prop-2-enylphenol |
|---|---|
| PubChem CID | 171480729 |
| Molecular Formula | C25H23F2NO2 |
| Molecular Weight | 407.46 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | 2-[(3,4-difluorophenyl)methylamino]-6-(2-hydroxy-5-prop-2-enylphenyl)-4-prop-2-enylphenol |
| SMILES | C=CCc1ccc(O)c(-c2cc(CC=C)cc(NCc3ccc(F)c(F)c3)c2O)c1 |
| InChI | InChI=1S/C25H23F2NO2/c1-3-5-16-8-10-24(29)19(11-16)20-12-17(6-4-2)14-23(25(20)30)28-15-18-7-9-21(26)22(27)13-18/h3-4,7-14,28-30H,1-2,5-6,15H2 |
| InChIKey | PSYHLPBYSSYABH-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.46 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|