C13H9BrF3NO — CID 63045152
2-bromo-4-[(2,3,4-trifluoroanilino)methyl]phenol (PubChem CID 63045152) has the molecular formula C13H9BrF3NO and a molecular weight of 332.12 g/mol. Its IUPAC name is 2-bromo-4-[(2,3,4-trifluoroanilino)methyl]phenol.
| Compound Name | 2-bromo-4-[(2,3,4-trifluoroanilino)methyl]phenol |
|---|---|
| PubChem CID | 63045152 |
| Molecular Formula | C13H9BrF3NO |
| Molecular Weight | 332.12 g/mol |
| Exact Mass | 330.98 |
| IUPAC Name | 2-bromo-4-[(2,3,4-trifluoroanilino)methyl]phenol |
| SMILES | Oc1ccc(CNc2ccc(F)c(F)c2F)cc1Br |
| InChI | InChI=1S/C13H9BrF3NO/c14-8-5-7(1-4-11(8)19)6-18-10-3-2-9(15)12(16)13(10)17/h1-5,18-19H,6H2 |
| InChIKey | IZFGSFOTKCETEJ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.12 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|