About 2-bromo-4-[[(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)amino]methyl]phenol
2-bromo-4-[[(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)amino]methyl]phenol (PubChem CID 63046068) has the molecular formula C15H13Br2NO3
and a molecular weight of 415.08 g/mol. Its IUPAC name is 2-bromo-4-[[(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)amino]methyl]phenol.
Molecular Properties
| Compound Name | 2-bromo-4-[[(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)amino]methyl]phenol |
| PubChem CID | 63046068 |
| Molecular Formula | C15H13Br2NO3 |
| Molecular Weight | 415.08 g/mol |
| Exact Mass | 412.93 |
| IUPAC Name | 2-bromo-4-[[(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)amino]methyl]phenol |
| SMILES | Oc1ccc(CNc2cc3c(cc2Br)OCCO3)cc1Br |
| InChI | InChI=1S/C15H13Br2NO3/c16-10-6-14-15(21-4-3-20-14)7-12(10)18-8-9-1-2-13(19)11(17)5-9/h1-2,5-7,18-19H,3-4,8H2 |
| InChIKey | KSUPQANGAVPRJP-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 415.08 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-4-[[(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)amino]methyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-4-[[(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)amino]methyl]phenol?
The IUPAC name of 2-bromo-4-[[(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)amino]methyl]phenol (CID 63046068) is 2-bromo-4-[[(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)amino]methyl]phenol.
What is the SMILES notation for 2-bromo-4-[[(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)amino]methyl]phenol?
The canonical SMILES for 2-bromo-4-[[(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)amino]methyl]phenol is Oc1ccc(CNc2cc3c(cc2Br)OCCO3)cc1Br.
What is the InChIKey of 2-bromo-4-[[(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)amino]methyl]phenol?
The InChIKey is KSUPQANGAVPRJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13Br2NO3/c16-10-6-14-15(21-4-3-20-14)7-12(10)18-8-9-1-2-13(19)11(17)5-9/h1-2,5-7,18-19H,3-4,8H2.
What are the key properties of 2-bromo-4-[[(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)amino]methyl]phenol?
2-bromo-4-[[(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)amino]methyl]phenol has a molecular weight of 415.08 g/mol, XLogP of 4.30, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-4-[[(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)amino]methyl]phenol is sourced from PubChem (CID 63046068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).