C14H12ClNO4 — CID 43685816
4-[[(6-chloro-1,3-benzodioxol-5-yl)amino]methyl]benzene-1,2-diol (PubChem CID 43685816) has the molecular formula C14H12ClNO4 and a molecular weight of 293.71 g/mol. Its IUPAC name is 4-[[(6-chloro-1,3-benzodioxol-5-yl)amino]methyl]benzene-1,2-diol.
| Compound Name | 4-[[(6-chloro-1,3-benzodioxol-5-yl)amino]methyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 43685816 |
| Molecular Formula | C14H12ClNO4 |
| Molecular Weight | 293.71 g/mol |
| Exact Mass | 293.05 |
| IUPAC Name | 4-[[(6-chloro-1,3-benzodioxol-5-yl)amino]methyl]benzene-1,2-diol |
| SMILES | Oc1ccc(CNc2cc3c(cc2Cl)OCO3)cc1O |
| InChI | InChI=1S/C14H12ClNO4/c15-9-4-13-14(20-7-19-13)5-10(9)16-6-8-1-2-11(17)12(18)3-8/h1-5,16-18H,6-7H2 |
| InChIKey | LFPRNXGEDZDHFX-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 70.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.71 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|