C13H9Cl4NO — CID 63419363
2-chloro-4-[(2,4,5-trichloroanilino)methyl]phenol (PubChem CID 63419363) has the molecular formula C13H9Cl4NO and a molecular weight of 337.03 g/mol. Its IUPAC name is 2-chloro-4-[(2,4,5-trichloroanilino)methyl]phenol.
| Compound Name | 2-chloro-4-[(2,4,5-trichloroanilino)methyl]phenol |
|---|---|
| PubChem CID | 63419363 |
| Molecular Formula | C13H9Cl4NO |
| Molecular Weight | 337.03 g/mol |
| Exact Mass | 334.94 |
| IUPAC Name | 2-chloro-4-[(2,4,5-trichloroanilino)methyl]phenol |
| SMILES | Oc1ccc(CNc2cc(Cl)c(Cl)cc2Cl)cc1Cl |
| InChI | InChI=1S/C13H9Cl4NO/c14-8-4-10(16)12(5-9(8)15)18-6-7-1-2-13(19)11(17)3-7/h1-5,18-19H,6H2 |
| InChIKey | NIAFZRCXQSAQGC-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.03 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|