C9H13ClN2O — CID 83003612
2-chloro-4-[(2,2-dimethylhydrazinyl)methyl]phenol (PubChem CID 83003612) has the molecular formula C9H13ClN2O and a molecular weight of 200.67 g/mol. Its IUPAC name is 2-chloro-4-[(2,2-dimethylhydrazinyl)methyl]phenol.
| Compound Name | 2-chloro-4-[(2,2-dimethylhydrazinyl)methyl]phenol |
|---|---|
| PubChem CID | 83003612 |
| Molecular Formula | C9H13ClN2O |
| Molecular Weight | 200.67 g/mol |
| Exact Mass | 200.07 |
| IUPAC Name | 2-chloro-4-[(2,2-dimethylhydrazinyl)methyl]phenol |
| SMILES | CN(C)NCc1ccc(O)c(Cl)c1 |
| InChI | InChI=1S/C9H13ClN2O/c1-12(2)11-6-7-3-4-9(13)8(10)5-7/h3-5,11,13H,6H2,1-2H3 |
| InChIKey | JGYZUDQLQVEJAY-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.67 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|