C14H10Cl2FNO2 — CID 81144730
6-chloro-N-[(3-chloro-4-fluorophenyl)methyl]-1,3-benzodioxol-5-amine (PubChem CID 81144730) has the molecular formula C14H10Cl2FNO2 and a molecular weight of 314.14 g/mol. Its IUPAC name is 6-chloro-N-[(3-chloro-4-fluorophenyl)methyl]-1,3-benzodioxol-5-amine.
| Compound Name | 6-chloro-N-[(3-chloro-4-fluorophenyl)methyl]-1,3-benzodioxol-5-amine |
|---|---|
| PubChem CID | 81144730 |
| Molecular Formula | C14H10Cl2FNO2 |
| Molecular Weight | 314.14 g/mol |
| Exact Mass | 313.01 |
| IUPAC Name | 6-chloro-N-[(3-chloro-4-fluorophenyl)methyl]-1,3-benzodioxol-5-amine |
| SMILES | Fc1ccc(CNc2cc3c(cc2Cl)OCO3)cc1Cl |
| InChI | InChI=1S/C14H10Cl2FNO2/c15-9-3-8(1-2-11(9)17)6-18-12-5-14-13(4-10(12)16)19-7-20-14/h1-5,18H,6-7H2 |
| InChIKey | OJDRXIMNDLGXBC-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.14 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|