C12H9BrClNO3 — CID 113344577
N-[(3-bromofuran-2-yl)methyl]-6-chloro-1,3-benzodioxol-5-amine (PubChem CID 113344577) has the molecular formula C12H9BrClNO3 and a molecular weight of 330.57 g/mol. Its IUPAC name is N-[(3-bromofuran-2-yl)methyl]-6-chloro-1,3-benzodioxol-5-amine.
| Compound Name | N-[(3-bromofuran-2-yl)methyl]-6-chloro-1,3-benzodioxol-5-amine |
|---|---|
| PubChem CID | 113344577 |
| Molecular Formula | C12H9BrClNO3 |
| Molecular Weight | 330.57 g/mol |
| Exact Mass | 328.95 |
| IUPAC Name | N-[(3-bromofuran-2-yl)methyl]-6-chloro-1,3-benzodioxol-5-amine |
| SMILES | Clc1cc2c(cc1NCc1occc1Br)OCO2 |
| InChI | InChI=1S/C12H9BrClNO3/c13-7-1-2-16-12(7)5-15-9-4-11-10(3-8(9)14)17-6-18-11/h1-4,15H,5-6H2 |
| InChIKey | CUBBFKJTLNINHS-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 43.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.57 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|