C13H14BrNO — CID 103818073
N-[(3-bromofuran-2-yl)methyl]-2,5-dimethylaniline (PubChem CID 103818073) has the molecular formula C13H14BrNO and a molecular weight of 280.16 g/mol. Its IUPAC name is N-[(3-bromofuran-2-yl)methyl]-2,5-dimethylaniline.
| Compound Name | N-[(3-bromofuran-2-yl)methyl]-2,5-dimethylaniline |
|---|---|
| PubChem CID | 103818073 |
| Molecular Formula | C13H14BrNO |
| Molecular Weight | 280.16 g/mol |
| Exact Mass | 279.03 |
| IUPAC Name | N-[(3-bromofuran-2-yl)methyl]-2,5-dimethylaniline |
| SMILES | Cc1ccc(C)c(NCc2occc2Br)c1 |
| InChI | InChI=1S/C13H14BrNO/c1-9-3-4-10(2)12(7-9)15-8-13-11(14)5-6-16-13/h3-7,15H,8H2,1-2H3 |
| InChIKey | GTCIGKJOXQVKHU-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.16 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |