C14H17BrN2O — CID 103817730
1-N-[(3-bromofuran-2-yl)methyl]-4-N,4-N,2-trimethylbenzene-1,4-diamine (PubChem CID 103817730) has the molecular formula C14H17BrN2O and a molecular weight of 309.21 g/mol. Its IUPAC name is 1-N-[(3-bromofuran-2-yl)methyl]-4-N,4-N,2-trimethylbenzene-1,4-diamine.
| Compound Name | 1-N-[(3-bromofuran-2-yl)methyl]-4-N,4-N,2-trimethylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 103817730 |
| Molecular Formula | C14H17BrN2O |
| Molecular Weight | 309.21 g/mol |
| Exact Mass | 308.05 |
| IUPAC Name | 1-N-[(3-bromofuran-2-yl)methyl]-4-N,4-N,2-trimethylbenzene-1,4-diamine |
| SMILES | Cc1cc(N(C)C)ccc1NCc1occc1Br |
| InChI | InChI=1S/C14H17BrN2O/c1-10-8-11(17(2)3)4-5-13(10)16-9-14-12(15)6-7-18-14/h4-8,16H,9H2,1-3H3 |
| InChIKey | UKHQSRJXGFRLDZ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 28.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.21 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|